About N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine
N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine (PubChem CID 91169316) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine |
| PubChem CID | 91169316 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine |
| SMILES | Cc1ncnc(NCC2CC2)n1 |
| InChI | InChI=1S/C8H12N4/c1-6-10-5-11-8(12-6)9-4-7-2-3-7/h5,7H,2-4H2,1H3,(H,9,10,11,12) |
| InChIKey | UKACPXWGRMYSQH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine?
The IUPAC name of N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine (CID 91169316) is N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine.
What is the SMILES notation for N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine?
The canonical SMILES for N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine is Cc1ncnc(NCC2CC2)n1.
What is the InChIKey of N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine?
The InChIKey is UKACPXWGRMYSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-6-10-5-11-8(12-6)9-4-7-2-3-7/h5,7H,2-4H2,1H3,(H,9,10,11,12).
What are the key properties of N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine?
N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine has a molecular weight of 164.21 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-4-methyl-1,3,5-triazin-2-amine is sourced from PubChem (CID 91169316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).