C19H31N5O5 — CID 91169991
methyl N'-[3-[1,3-dihydroxy-7-methyl-2-[4-(methylamino)-4-oxobutyl]-4,5,6,7-tetrahydroisoindol-4-yl]propanoylamino]carbamimidate (PubChem CID 91169991) has the molecular formula C19H31N5O5 and a molecular weight of 409.49 g/mol. Its IUPAC name is methyl N'-[3-[1,3-dihydroxy-7-methyl-2-[4-(methylamino)-4-oxobutyl]-4,5,6,7-tetrahydroisoindol-4-yl]propanoylamino]carbamimidate.
| Compound Name | methyl N'-[3-[1,3-dihydroxy-7-methyl-2-[4-(methylamino)-4-oxobutyl]-4,5,6,7-tetrahydroisoindol-4-yl]propanoylamino]carbamimidate |
|---|---|
| PubChem CID | 91169991 |
| Molecular Formula | C19H31N5O5 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | methyl N'-[3-[1,3-dihydroxy-7-methyl-2-[4-(methylamino)-4-oxobutyl]-4,5,6,7-tetrahydroisoindol-4-yl]propanoylamino]carbamimidate |
| SMILES | CNC(=O)CCCn1c(O)c2c(c1O)C(CCC(=O)NN=C(N)OC)CCC2C |
| InChI | InChI=1S/C19H31N5O5/c1-11-6-7-12(8-9-14(26)22-23-19(20)29-3)16-15(11)17(27)24(18(16)28)10-4-5-13(25)21-2/h11-12,27-28H,4-10H2,1-3H3,(H2,20,23)(H,21,25)(H,22,26) |
| InChIKey | PUBCAXVHUFVVIY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 151.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|