About pent-3-en-2-ylphosphane
pent-3-en-2-ylphosphane (PubChem CID 91170639) has the molecular formula C5H11P
and a molecular weight of 102.12 g/mol. Its IUPAC name is pent-3-en-2-ylphosphane.
Molecular Properties
| Compound Name | pent-3-en-2-ylphosphane |
| PubChem CID | 91170639 |
| Molecular Formula | C5H11P |
| Molecular Weight | 102.12 g/mol |
| Exact Mass | 102.06 |
| IUPAC Name | pent-3-en-2-ylphosphane |
| SMILES | CC=CC(C)P |
| InChI | InChI=1S/C5H11P/c1-3-4-5(2)6/h3-5H,6H2,1-2H3 |
| InChIKey | ZBJJWARZUHVTHD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.12 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pent-3-en-2-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-3-en-2-ylphosphane?
The IUPAC name of pent-3-en-2-ylphosphane (CID 91170639) is pent-3-en-2-ylphosphane.
What is the SMILES notation for pent-3-en-2-ylphosphane?
The canonical SMILES for pent-3-en-2-ylphosphane is CC=CC(C)P.
What is the InChIKey of pent-3-en-2-ylphosphane?
The InChIKey is ZBJJWARZUHVTHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11P/c1-3-4-5(2)6/h3-5H,6H2,1-2H3.
What are the key properties of pent-3-en-2-ylphosphane?
pent-3-en-2-ylphosphane has a molecular weight of 102.12 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pent-3-en-2-ylphosphane is sourced from PubChem (CID 91170639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).