About N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine
N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine (PubChem CID 91170852) has the molecular formula C8H10FN
and a molecular weight of 139.17 g/mol. Its IUPAC name is N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine.
Molecular Properties
| Compound Name | N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine |
| PubChem CID | 91170852 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine |
| SMILES | C=NC(=C)C(F)=CC(=C)C |
| InChI | InChI=1S/C8H10FN/c1-6(2)5-8(9)7(3)10-4/h5H,1,3-4H2,2H3 |
| InChIKey | OPAXTXANOQADLF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine?
The IUPAC name of N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine (CID 91170852) is N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine.
What is the SMILES notation for N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine?
The canonical SMILES for N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine is C=NC(=C)C(F)=CC(=C)C.
What is the InChIKey of N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine?
The InChIKey is OPAXTXANOQADLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN/c1-6(2)5-8(9)7(3)10-4/h5H,1,3-4H2,2H3.
What are the key properties of N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine?
N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine has a molecular weight of 139.17 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluoro-5-methylhexa-1,3,5-trien-2-yl)methanimine is sourced from PubChem (CID 91170852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).