About 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine
3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine (PubChem CID 911710) has the molecular formula C19H14N2O2S
and a molecular weight of 334.40 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine.
Molecular Properties
| Compound Name | 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine |
| PubChem CID | 911710 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine |
| SMILES | [H]/N=c1\oc2ccccc2cc1-c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C19H14N2O2S/c1-22-14-8-6-12(7-9-14)16-11-24-19(21-16)15-10-13-4-2-3-5-17(13)23-18(15)20/h2-11,20H,1H3/b20-18- |
| InChIKey | WZPKIPXIOLOHFM-ZZEZOPTASA-N |
| XLogP | 4.71 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine?
The IUPAC name of 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine (CID 911710) is 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine.
What is the SMILES notation for 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine?
The canonical SMILES for 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine is [H]/N=c1\oc2ccccc2cc1-c1nc(-c2ccc(OC)cc2)cs1.
What is the InChIKey of 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine?
The InChIKey is WZPKIPXIOLOHFM-ZZEZOPTASA-N. The full InChI is InChI=1S/C19H14N2O2S/c1-22-14-8-6-12(7-9-14)16-11-24-19(21-16)15-10-13-4-2-3-5-17(13)23-18(15)20/h2-11,20H,1H3/b20-18-.
What are the key properties of 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine?
3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine has a molecular weight of 334.40 g/mol, XLogP of 4.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]chromen-2-imine is sourced from PubChem (CID 911710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).