About N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide
N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide (PubChem CID 91171043) has the molecular formula C11H17NO3S
and a molecular weight of 243.33 g/mol. Its IUPAC name is N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide |
| PubChem CID | 91171043 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1c(C)ccc(C)c1C |
| InChI | InChI=1S/C11H17NO3S/c1-8-6-7-9(2)11(10(8)3)16(13,14)12(4)15-5/h6-7H,1-5H3 |
| InChIKey | QDNKADUOKHMUGV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide?
The IUPAC name of N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide (CID 91171043) is N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide.
What is the SMILES notation for N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide?
The canonical SMILES for N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide is CON(C)S(=O)(=O)c1c(C)ccc(C)c1C.
What is the InChIKey of N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide?
The InChIKey is QDNKADUOKHMUGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3S/c1-8-6-7-9(2)11(10(8)3)16(13,14)12(4)15-5/h6-7H,1-5H3.
What are the key properties of N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide?
N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide has a molecular weight of 243.33 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N,2,3,6-tetramethylbenzenesulfonamide is sourced from PubChem (CID 91171043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).