About 6,7-dihydro-5H-1-benzofuran-4-one;ethane
6,7-dihydro-5H-1-benzofuran-4-one;ethane (PubChem CID 91171294) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 6,7-dihydro-5H-1-benzofuran-4-one;ethane.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-1-benzofuran-4-one;ethane |
| PubChem CID | 91171294 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 6,7-dihydro-5H-1-benzofuran-4-one;ethane |
| SMILES | CC.CC.O=C1CCCc2occc21 |
| InChI | InChI=1S/C8H8O2.2C2H6/c9-7-2-1-3-8-6(7)4-5-10-8;2*1-2/h4-5H,1-3H2;2*1-2H3 |
| InChIKey | IIUDPLYCERDSMO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dihydro-5H-1-benzofuran-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-1-benzofuran-4-one;ethane?
The IUPAC name of 6,7-dihydro-5H-1-benzofuran-4-one;ethane (CID 91171294) is 6,7-dihydro-5H-1-benzofuran-4-one;ethane.
What is the SMILES notation for 6,7-dihydro-5H-1-benzofuran-4-one;ethane?
The canonical SMILES for 6,7-dihydro-5H-1-benzofuran-4-one;ethane is CC.CC.O=C1CCCc2occc21.
What is the InChIKey of 6,7-dihydro-5H-1-benzofuran-4-one;ethane?
The InChIKey is IIUDPLYCERDSMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.2C2H6/c9-7-2-1-3-8-6(7)4-5-10-8;2*1-2/h4-5H,1-3H2;2*1-2H3.
What are the key properties of 6,7-dihydro-5H-1-benzofuran-4-one;ethane?
6,7-dihydro-5H-1-benzofuran-4-one;ethane has a molecular weight of 196.29 g/mol, XLogP of 3.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-1-benzofuran-4-one;ethane is sourced from PubChem (CID 91171294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).