About 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate
2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate (PubChem CID 91171427) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate.
Molecular Properties
| Compound Name | 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate |
| PubChem CID | 91171427 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate |
| SMILES | CCC(=O)CC(=CC(=O)OC(C)(C)C(C)C)OC |
| InChI | InChI=1S/C14H24O4/c1-7-11(15)8-12(17-6)9-13(16)18-14(4,5)10(2)3/h9-10H,7-8H2,1-6H3 |
| InChIKey | FNJABXKTBBOKRO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate?
The IUPAC name of 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate (CID 91171427) is 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate.
What is the SMILES notation for 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate?
The canonical SMILES for 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate is CCC(=O)CC(=CC(=O)OC(C)(C)C(C)C)OC.
What is the InChIKey of 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate?
The InChIKey is FNJABXKTBBOKRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4/c1-7-11(15)8-12(17-6)9-13(16)18-14(4,5)10(2)3/h9-10H,7-8H2,1-6H3.
What are the key properties of 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate?
2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate has a molecular weight of 256.34 g/mol, XLogP of 2.86, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutan-2-yl 3-methoxy-5-oxohept-2-enoate is sourced from PubChem (CID 91171427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).