C25H26FN3O6S2 — CID 91171588
(1R,8S)-3-[(4-fluorophenyl)methyl]-5-[7-(methoxymethoxymethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione (PubChem CID 91171588) has the molecular formula C25H26FN3O6S2 and a molecular weight of 547.63 g/mol. Its IUPAC name is (1R,8S)-3-[(4-fluorophenyl)methyl]-5-[7-(methoxymethoxymethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione.
| Compound Name | (1R,8S)-3-[(4-fluorophenyl)methyl]-5-[7-(methoxymethoxymethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
|---|---|
| PubChem CID | 91171588 |
| Molecular Formula | C25H26FN3O6S2 |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | (1R,8S)-3-[(4-fluorophenyl)methyl]-5-[7-(methoxymethoxymethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
| SMILES | COCOCc1csc2c1S(=O)(=O)N=C(C1C(=O)C3C([C@@H]4CC[C@H]3C4)N(Cc3ccc(F)cc3)C1=O)N2 |
| InChI | InChI=1S/C25H26FN3O6S2/c1-34-12-35-10-16-11-36-24-22(16)37(32,33)28-23(27-24)19-21(30)18-14-4-5-15(8-14)20(18)29(25(19)31)9-13-2-6-17(26)7-3-13/h2-3,6-7,11,14-15,18-20H,4-5,8-10,12H2,1H3,(H,27,28)/t14-,15+,18?,19?,20?/m0/s1 |
| InChIKey | SXGVVTQNMILRJO-MOESFIOCSA-N |
| XLogP | 3.16 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|