C28H30FN3O5 — CID 91171875
N-[1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-(3-methoxyphenyl)propan-2-yl]-2-(2-methoxyethoxy)acetamide (PubChem CID 91171875) has the molecular formula C28H30FN3O5 and a molecular weight of 507.56 g/mol. Its IUPAC name is N-[1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-(3-methoxyphenyl)propan-2-yl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-(3-methoxyphenyl)propan-2-yl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 91171875 |
| Molecular Formula | C28H30FN3O5 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-[1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-(3-methoxyphenyl)propan-2-yl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NC(C)C(Oc1ccc2c(cnn2-c2ccc(F)cc2)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C28H30FN3O5/c1-19(31-27(33)18-36-14-13-34-2)28(20-5-4-6-24(15-20)35-3)37-25-11-12-26-21(16-25)17-30-32(26)23-9-7-22(29)8-10-23/h4-12,15-17,19,28H,13-14,18H2,1-3H3,(H,31,33) |
| InChIKey | HKCVYBJKNTXYGE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|