About N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide
N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide (PubChem CID 91171916) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide.
Molecular Properties
| Compound Name | N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide |
| PubChem CID | 91171916 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide |
| SMILES | CC(=O)/N=C1\C=CC(=O)C(=O)C1 |
| InChI | InChI=1S/C8H7NO3/c1-5(10)9-6-2-3-7(11)8(12)4-6/h2-3H,4H2,1H3/b9-6+ |
| InChIKey | LUMSYRHSEJDHSN-RMKNXTFCSA-N |
| XLogP | 0.07 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide?
The IUPAC name of N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide (CID 91171916) is N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide.
What is the SMILES notation for N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide?
The canonical SMILES for N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide is CC(=O)/N=C1\C=CC(=O)C(=O)C1.
What is the InChIKey of N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide?
The InChIKey is LUMSYRHSEJDHSN-RMKNXTFCSA-N. The full InChI is InChI=1S/C8H7NO3/c1-5(10)9-6-2-3-7(11)8(12)4-6/h2-3H,4H2,1H3/b9-6+.
What are the key properties of N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide?
N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide has a molecular weight of 165.15 g/mol, XLogP of 0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dioxocyclohex-2-en-1-ylidene)acetamide is sourced from PubChem (CID 91171916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).