C32H38N6O — CID 91172040
1-[(1S)-1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-2-(2-phenylethoxy)ethyl]-4-(3-phenylprop-2-enyl)piperazine (PubChem CID 91172040) has the molecular formula C32H38N6O and a molecular weight of 522.70 g/mol. Its IUPAC name is 1-[(1S)-1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-2-(2-phenylethoxy)ethyl]-4-(3-phenylprop-2-enyl)piperazine.
| Compound Name | 1-[(1S)-1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-2-(2-phenylethoxy)ethyl]-4-(3-phenylprop-2-enyl)piperazine |
|---|---|
| PubChem CID | 91172040 |
| Molecular Formula | C32H38N6O |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | 1-[(1S)-1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-2-(2-phenylethoxy)ethyl]-4-(3-phenylprop-2-enyl)piperazine |
| SMILES | Cc1cccc(C)c1-n1nnnc1[C@@H](COCCc1ccccc1)N1CCN(CC=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H38N6O/c1-26-11-9-12-27(2)31(26)38-32(33-34-35-38)30(25-39-24-18-29-15-7-4-8-16-29)37-22-20-36(21-23-37)19-10-17-28-13-5-3-6-14-28/h3-17,30H,18-25H2,1-2H3/t30-/m1/s1 |
| InChIKey | UEGQEJIUYSRRPC-SSEXGKCCSA-N |
| XLogP | 4.91 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|