C11H18N4O3 — CID 91172340
tert-butyl 2-(hydroxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 91172340) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | tert-butyl 2-(hydroxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 91172340 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CNCc2nc(CO)nn21 |
| InChI | InChI=1S/C11H18N4O3/c1-11(2,3)18-10(17)7-4-12-5-9-13-8(6-16)14-15(7)9/h7,12,16H,4-6H2,1-3H3 |
| InChIKey | WODOMLCOOZOMSF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |