C15H19N3 — CID 91172355
3-(12-methyl-7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-4-yl)propan-1-amine (PubChem CID 91172355) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 3-(12-methyl-7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-4-yl)propan-1-amine.
| Compound Name | 3-(12-methyl-7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 91172355 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 3-(12-methyl-7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-4-yl)propan-1-amine |
| SMILES | CC1=CC2=C3C=C(CCCN)C=CN3CN2C=C1 |
| InChI | InChI=1S/C15H19N3/c1-12-4-7-17-11-18-8-5-13(3-2-6-16)10-15(18)14(17)9-12/h4-5,7-10H,2-3,6,11,16H2,1H3 |
| InChIKey | YFXRDXZKWXRNQZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |