About 3,6,8-tribromoquinoline
3,6,8-tribromoquinoline (PubChem CID 91172401) has the molecular formula C9H4Br3N
and a molecular weight of 365.85 g/mol. Its IUPAC name is 3,6,8-tribromoquinoline.
Molecular Properties
| Compound Name | 3,6,8-tribromoquinoline |
| PubChem CID | 91172401 |
| Molecular Formula | C9H4Br3N |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 362.79 |
| IUPAC Name | 3,6,8-tribromoquinoline |
| SMILES | Brc1cnc2c(Br)cc(Br)cc2c1 |
| InChI | InChI=1S/C9H4Br3N/c10-6-1-5-2-7(11)4-13-9(5)8(12)3-6/h1-4H |
| InChIKey | BWLLHQAEWSCQSO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6,8-tribromoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6,8-tribromoquinoline?
The IUPAC name of 3,6,8-tribromoquinoline (CID 91172401) is 3,6,8-tribromoquinoline.
What is the SMILES notation for 3,6,8-tribromoquinoline?
The canonical SMILES for 3,6,8-tribromoquinoline is Brc1cnc2c(Br)cc(Br)cc2c1.
What is the InChIKey of 3,6,8-tribromoquinoline?
The InChIKey is BWLLHQAEWSCQSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Br3N/c10-6-1-5-2-7(11)4-13-9(5)8(12)3-6/h1-4H.
What are the key properties of 3,6,8-tribromoquinoline?
3,6,8-tribromoquinoline has a molecular weight of 365.85 g/mol, XLogP of 4.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6,8-tribromoquinoline is sourced from PubChem (CID 91172401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).