About ethane;hydrazine;7-methyl-1H-indole
ethane;hydrazine;7-methyl-1H-indole (PubChem CID 91172685) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;hydrazine;7-methyl-1H-indole.
Molecular Properties
| Compound Name | ethane;hydrazine;7-methyl-1H-indole |
| PubChem CID | 91172685 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | ethane;hydrazine;7-methyl-1H-indole |
| SMILES | CC.Cc1cccc2cc[nH]c12.NN |
| InChI | InChI=1S/C9H9N.C2H6.H4N2/c1-7-3-2-4-8-5-6-10-9(7)8;2*1-2/h2-6,10H,1H3;1-2H3;1-2H2 |
| InChIKey | SUSLKCHJXXZQFL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;hydrazine;7-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;hydrazine;7-methyl-1H-indole?
The IUPAC name of ethane;hydrazine;7-methyl-1H-indole (CID 91172685) is ethane;hydrazine;7-methyl-1H-indole.
What is the SMILES notation for ethane;hydrazine;7-methyl-1H-indole?
The canonical SMILES for ethane;hydrazine;7-methyl-1H-indole is CC.Cc1cccc2cc[nH]c12.NN.
What is the InChIKey of ethane;hydrazine;7-methyl-1H-indole?
The InChIKey is SUSLKCHJXXZQFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2H6.H4N2/c1-7-3-2-4-8-5-6-10-9(7)8;2*1-2/h2-6,10H,1H3;1-2H3;1-2H2.
What are the key properties of ethane;hydrazine;7-methyl-1H-indole?
ethane;hydrazine;7-methyl-1H-indole has a molecular weight of 193.29 g/mol, XLogP of 2.32, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;hydrazine;7-methyl-1H-indole is sourced from PubChem (CID 91172685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).