C29H28ClFN2O — CID 91172739
2-[(2S,7R)-13-(2-chlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-trien-4-yl]-1-(4-fluorophenyl)butan-1-one (PubChem CID 91172739) has the molecular formula C29H28ClFN2O and a molecular weight of 475.01 g/mol. Its IUPAC name is 2-[(2S,7R)-13-(2-chlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-trien-4-yl]-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 2-[(2S,7R)-13-(2-chlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-trien-4-yl]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 91172739 |
| Molecular Formula | C29H28ClFN2O |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 2-[(2S,7R)-13-(2-chlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-trien-4-yl]-1-(4-fluorophenyl)butan-1-one |
| SMILES | CCC(C(=O)c1ccc(F)cc1)N1CC[C@@H]2[C@H](C1)c1cc(-c3ccccc3Cl)cc3c1N2CC3 |
| InChI | InChI=1S/C29H28ClFN2O/c1-2-26(29(34)18-7-9-21(31)10-8-18)32-13-12-27-24(17-32)23-16-20(22-5-3-4-6-25(22)30)15-19-11-14-33(27)28(19)23/h3-10,15-16,24,26-27H,2,11-14,17H2,1H3/t24-,26?,27-/m1/s1 |
| InChIKey | PATJCRXWNKEFPN-FXQIWMCUSA-N |
| XLogP | 6.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |