C24H33N3O3Si — CID 91172770
(3S,4R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-4-methyloxan-3-ol (PubChem CID 91172770) has the molecular formula C24H33N3O3Si and a molecular weight of 439.63 g/mol. Its IUPAC name is (3S,4R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-4-methyloxan-3-ol.
| Compound Name | (3S,4R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-4-methyloxan-3-ol |
|---|---|
| PubChem CID | 91172770 |
| Molecular Formula | C24H33N3O3Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (3S,4R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-4-methyloxan-3-ol |
| SMILES | CCC1O[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(N=[N+]=[N-])[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C24H33N3O3Si/c1-6-20-22(28)17(2)21(26-27-25)23(29-20)30-31(24(3,4)5,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-17,20-23,28H,6H2,1-5H3/t17-,20?,21?,22+,23+/m1/s1 |
| InChIKey | RBUYYFGETACKOP-RPFHPVAYSA-N |
| XLogP | 4.37 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|