C22H20Cl3N2O7S2+ — CID 91172833
2-[5-chloro-2-[2-[[5,6-dichloro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]thieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid (PubChem CID 91172833) has the molecular formula C22H20Cl3N2O7S2+ and a molecular weight of 594.90 g/mol. Its IUPAC name is 2-[5-chloro-2-[2-[[5,6-dichloro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]thieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[5-chloro-2-[2-[[5,6-dichloro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]thieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 91172833 |
| Molecular Formula | C22H20Cl3N2O7S2+ |
| Molecular Weight | 594.90 g/mol |
| Exact Mass | 592.98 |
| IUPAC Name | 2-[5-chloro-2-[2-[[5,6-dichloro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]thieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid |
| SMILES | CCC(=Cc1oc2sc(Cl)cc2[n+]1CC(=O)O)C=C1Oc2cc(Cl)c(Cl)cc2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C22H19Cl3N2O7S2/c1-2-12(7-20-27(11-21(28)29)16-10-18(25)35-22(16)34-20)6-19-26(4-3-5-36(30,31)32)15-8-13(23)14(24)9-17(15)33-19/h6-10H,2-5,11H2,1H3,(H-,28,29,30,31,32)/p+1 |
| InChIKey | DOHBHHJPOPCCMI-UHFFFAOYSA-O |
| XLogP | 5.64 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|