About N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide
N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide (PubChem CID 91173187) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide.
Molecular Properties
| Compound Name | N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide |
| PubChem CID | 91173187 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide |
| SMILES | CC(=O)N(C)[C@@H]1CNCO1 |
| InChI | InChI=1S/C6H12N2O2/c1-5(9)8(2)6-3-7-4-10-6/h6-7H,3-4H2,1-2H3/t6-/m0/s1 |
| InChIKey | BJEOVRQPZUXZLU-LURJTMIESA-N |
| XLogP | -0.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide?
The IUPAC name of N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide (CID 91173187) is N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide.
What is the SMILES notation for N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide?
The canonical SMILES for N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide is CC(=O)N(C)[C@@H]1CNCO1.
What is the InChIKey of N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide?
The InChIKey is BJEOVRQPZUXZLU-LURJTMIESA-N. The full InChI is InChI=1S/C6H12N2O2/c1-5(9)8(2)6-3-7-4-10-6/h6-7H,3-4H2,1-2H3/t6-/m0/s1.
What are the key properties of N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide?
N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide has a molecular weight of 144.17 g/mol, XLogP of -0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(5S)-1,3-oxazolidin-5-yl]acetamide is sourced from PubChem (CID 91173187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).