C17H17N3OS — CID 911733
6-amino-3,3-dimethyl-7-phenyl-8-sulfanylidene-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile (PubChem CID 911733) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 6-amino-3,3-dimethyl-7-phenyl-8-sulfanylidene-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile.
| Compound Name | 6-amino-3,3-dimethyl-7-phenyl-8-sulfanylidene-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 911733 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 6-amino-3,3-dimethyl-7-phenyl-8-sulfanylidene-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
| SMILES | CC1(C)Cc2c(C#N)c(N)n(-c3ccccc3)c(=S)c2CO1 |
| InChI | InChI=1S/C17H17N3OS/c1-17(2)8-12-13(9-18)15(19)20(11-6-4-3-5-7-11)16(22)14(12)10-21-17/h3-7H,8,10,19H2,1-2H3 |
| InChIKey | XMLPEVVGVVSTTD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|