About 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane
1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane (PubChem CID 91173457) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane.
Molecular Properties
| Compound Name | 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane |
| PubChem CID | 91173457 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane |
| SMILES | CCC1(C)C(=C(C)C)CC1C |
| InChI | InChI=1S/C11H20/c1-6-11(5)9(4)7-10(11)8(2)3/h9H,6-7H2,1-5H3 |
| InChIKey | AQRORZVFTJXTLH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane?
The IUPAC name of 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane (CID 91173457) is 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane.
What is the SMILES notation for 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane?
The canonical SMILES for 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane is CCC1(C)C(=C(C)C)CC1C.
What is the InChIKey of 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane?
The InChIKey is AQRORZVFTJXTLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20/c1-6-11(5)9(4)7-10(11)8(2)3/h9H,6-7H2,1-5H3.
What are the key properties of 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane?
1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane has a molecular weight of 152.28 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,2-dimethyl-4-propan-2-ylidenecyclobutane is sourced from PubChem (CID 91173457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).