About 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene
9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene (PubChem CID 91173637) has the molecular formula C15H21F3
and a molecular weight of 258.33 g/mol. Its IUPAC name is 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene.
Molecular Properties
| Compound Name | 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene |
| PubChem CID | 91173637 |
| Molecular Formula | C15H21F3 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene |
| SMILES | C=C(C=CC=C(C=CCC)C(F)(F)F)CCCC |
| InChI | InChI=1S/C15H21F3/c1-4-6-9-13(3)10-8-12-14(11-7-5-2)15(16,17)18/h7-8,10-12H,3-6,9H2,1-2H3 |
| InChIKey | GSCQHUAACOLUNN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene?
The IUPAC name of 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene (CID 91173637) is 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene.
What is the SMILES notation for 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene?
The canonical SMILES for 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene is C=C(C=CC=C(C=CCC)C(F)(F)F)CCCC.
What is the InChIKey of 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene?
The InChIKey is GSCQHUAACOLUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F3/c1-4-6-9-13(3)10-8-12-14(11-7-5-2)15(16,17)18/h7-8,10-12H,3-6,9H2,1-2H3.
What are the key properties of 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene?
9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene has a molecular weight of 258.33 g/mol, XLogP of 5.74, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylidene-5-(trifluoromethyl)trideca-3,5,7-triene is sourced from PubChem (CID 91173637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).