C15H26N8O — CID 91173697
2,2-bis(2H-tetrazol-5-yl)tridecan-7-one (PubChem CID 91173697) has the molecular formula C15H26N8O and a molecular weight of 334.43 g/mol. Its IUPAC name is 2,2-bis(2H-tetrazol-5-yl)tridecan-7-one.
| Compound Name | 2,2-bis(2H-tetrazol-5-yl)tridecan-7-one |
|---|---|
| PubChem CID | 91173697 |
| Molecular Formula | C15H26N8O |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 2,2-bis(2H-tetrazol-5-yl)tridecan-7-one |
| SMILES | CCCCCCC(=O)CCCCC(C)(c1nn[nH]n1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H26N8O/c1-3-4-5-6-9-12(24)10-7-8-11-15(2,13-16-20-21-17-13)14-18-22-23-19-14/h3-11H2,1-2H3,(H,16,17,20,21)(H,18,19,22,23) |
| InChIKey | PJHIYTGQPQTCHP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|