About 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile
8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile (PubChem CID 91174026) has the molecular formula C14H8N4
and a molecular weight of 232.25 g/mol. Its IUPAC name is 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| PubChem CID | 91174026 |
| Molecular Formula | C14H8N4 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| SMILES | Cc1cccc2c3nc(C#N)c(C#N)[nH]c-3cc12 |
| InChI | InChI=1S/C14H8N4/c1-8-3-2-4-9-10(8)5-11-14(9)18-13(7-16)12(6-15)17-11/h2-5,17H,1H3 |
| InChIKey | YNBGOZPVYSHKRE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The IUPAC name of 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile (CID 91174026) is 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The canonical SMILES for 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile is Cc1cccc2c3nc(C#N)c(C#N)[nH]c-3cc12.
What is the InChIKey of 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The InChIKey is YNBGOZPVYSHKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N4/c1-8-3-2-4-9-10(8)5-11-14(9)18-13(7-16)12(6-15)17-11/h2-5,17H,1H3.
What are the key properties of 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile?
8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile has a molecular weight of 232.25 g/mol, XLogP of 2.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 91174026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).