C28H43NO9 — CID 91174178
[4-[(2S)-2-amino-3-oxo-3-[(2S)-2-propoxycarbonyloxypropoxy]propyl]-2-hexanoyloxyphenyl] hexanoate (PubChem CID 91174178) has the molecular formula C28H43NO9 and a molecular weight of 537.65 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-oxo-3-[(2S)-2-propoxycarbonyloxypropoxy]propyl]-2-hexanoyloxyphenyl] hexanoate.
| Compound Name | [4-[(2S)-2-amino-3-oxo-3-[(2S)-2-propoxycarbonyloxypropoxy]propyl]-2-hexanoyloxyphenyl] hexanoate |
|---|---|
| PubChem CID | 91174178 |
| Molecular Formula | C28H43NO9 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | [4-[(2S)-2-amino-3-oxo-3-[(2S)-2-propoxycarbonyloxypropoxy]propyl]-2-hexanoyloxyphenyl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccc(C[C@H](N)C(=O)OC[C@H](C)OC(=O)OCCC)cc1OC(=O)CCCCC |
| InChI | InChI=1S/C28H43NO9/c1-5-8-10-12-25(30)37-23-15-14-21(18-24(23)38-26(31)13-11-9-6-2)17-22(29)27(32)35-19-20(4)36-28(33)34-16-7-3/h14-15,18,20,22H,5-13,16-17,19,29H2,1-4H3/t20-,22-/m0/s1 |
| InChIKey | OOQMQEIZZHKWBN-UNMCSNQZSA-N |
| XLogP | 5.02 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|