C41H58N2O2 — CID 91174444
3-[2-[15-ethyl-4-methyl-9-[[4-(8-methylcycloocta-1,3,5-trien-1-yl)phenyl]methylimino]-13-azabicyclo[8.5.0]pentadeca-1(10),4,13-trien-5-yl]ethyl]hexane-1,6-diol (PubChem CID 91174444) has the molecular formula C41H58N2O2 and a molecular weight of 610.93 g/mol. Its IUPAC name is 3-[2-[15-ethyl-4-methyl-9-[[4-(8-methylcycloocta-1,3,5-trien-1-yl)phenyl]methylimino]-13-azabicyclo[8.5.0]pentadeca-1(10),4,13-trien-5-yl]ethyl]hexane-1,6-diol.
| Compound Name | 3-[2-[15-ethyl-4-methyl-9-[[4-(8-methylcycloocta-1,3,5-trien-1-yl)phenyl]methylimino]-13-azabicyclo[8.5.0]pentadeca-1(10),4,13-trien-5-yl]ethyl]hexane-1,6-diol |
|---|---|
| PubChem CID | 91174444 |
| Molecular Formula | C41H58N2O2 |
| Molecular Weight | 610.93 g/mol |
| Exact Mass | 610.45 |
| IUPAC Name | 3-[2-[15-ethyl-4-methyl-9-[[4-(8-methylcycloocta-1,3,5-trien-1-yl)phenyl]methylimino]-13-azabicyclo[8.5.0]pentadeca-1(10),4,13-trien-5-yl]ethyl]hexane-1,6-diol |
| SMILES | CCC1C=NCCC2=C1CCC(C)=C(CCC(CCO)CCCO)CCC/C2=N\Cc1ccc(C2=CC=CC=CCC2C)cc1 |
| InChI | InChI=1S/C41H58N2O2/c1-4-35-30-42-26-24-40-39(35)23-16-31(2)36(20-17-33(25-28-45)12-10-27-44)13-9-15-41(40)43-29-34-18-21-37(22-19-34)38-14-8-6-5-7-11-32(38)3/h5-8,14,18-19,21-22,30,32-33,35,44-45H,4,9-13,15-17,20,23-29H2,1-3H3/b7-5?,8-6?,36-31?,38-14?,43-41+ |
| InChIKey | CUARJLIWXMKJHI-IPRSNAOBSA-N |
| XLogP | 9.79 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.93 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|