C11H23NOS — CID 91174628
1-(2,2-diethylmorpholin-4-yl)propane-2-thiol (PubChem CID 91174628) has the molecular formula C11H23NOS and a molecular weight of 217.38 g/mol. Its IUPAC name is 1-(2,2-diethylmorpholin-4-yl)propane-2-thiol.
| Compound Name | 1-(2,2-diethylmorpholin-4-yl)propane-2-thiol |
|---|---|
| PubChem CID | 91174628 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-(2,2-diethylmorpholin-4-yl)propane-2-thiol |
| SMILES | CCC1(CC)CN(CC(C)S)CCO1 |
| InChI | InChI=1S/C11H23NOS/c1-4-11(5-2)9-12(6-7-13-11)8-10(3)14/h10,14H,4-9H2,1-3H3 |
| InChIKey | CUCQYHNLBBFMTG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|