C17H29NO3 — CID 91175164
(1S,2R,14S)-14-methoxy-2,4-dimethyl-7-nitrosocyclotetradeca-3,12-dien-1-ol (PubChem CID 91175164) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is (1S,2R,14S)-14-methoxy-2,4-dimethyl-7-nitrosocyclotetradeca-3,12-dien-1-ol.
| Compound Name | (1S,2R,14S)-14-methoxy-2,4-dimethyl-7-nitrosocyclotetradeca-3,12-dien-1-ol |
|---|---|
| PubChem CID | 91175164 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | (1S,2R,14S)-14-methoxy-2,4-dimethyl-7-nitrosocyclotetradeca-3,12-dien-1-ol |
| SMILES | CO[C@H]1C=CCCCCC(N=O)CCC(C)=C[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C17H29NO3/c1-13-10-11-15(18-20)8-6-4-5-7-9-16(21-3)17(19)14(2)12-13/h7,9,12,14-17,19H,4-6,8,10-11H2,1-3H3/t14-,15?,16+,17+/m1/s1 |
| InChIKey | NIKIDXMTINMVQR-XOJKTNQZSA-N |
| XLogP | 3.99 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|