C21H23FN2O — CID 91175542
5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-1-prop-2-enyl-2,3,6,7-tetrahydroindene-1-carbaldehyde (PubChem CID 91175542) has the molecular formula C21H23FN2O and a molecular weight of 338.43 g/mol. Its IUPAC name is 5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-1-prop-2-enyl-2,3,6,7-tetrahydroindene-1-carbaldehyde.
| Compound Name | 5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-1-prop-2-enyl-2,3,6,7-tetrahydroindene-1-carbaldehyde |
|---|---|
| PubChem CID | 91175542 |
| Molecular Formula | C21H23FN2O |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-1-prop-2-enyl-2,3,6,7-tetrahydroindene-1-carbaldehyde |
| SMILES | [H]/N=C/C1CC2(C)C(=C/C1=N\c1ccc(F)cc1)CCC2(C=O)CC=C |
| InChI | InChI=1S/C21H23FN2O/c1-3-9-21(14-25)10-8-16-11-19(15(13-23)12-20(16,21)2)24-18-6-4-17(22)5-7-18/h3-7,11,13-15,23H,1,8-10,12H2,2H3/b23-13+,24-19+ |
| InChIKey | WXERKJCBTOPJDR-JUDCTDMSSA-N |
| XLogP | 5.06 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|