About 3,4-diiminohexane-2,5-diamine
3,4-diiminohexane-2,5-diamine (PubChem CID 91176744) has the molecular formula C6H14N4
and a molecular weight of 142.21 g/mol. Its IUPAC name is 3,4-diiminohexane-2,5-diamine.
Molecular Properties
| Compound Name | 3,4-diiminohexane-2,5-diamine |
| PubChem CID | 91176744 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 3,4-diiminohexane-2,5-diamine |
| SMILES | [H]/N=C(C(=N/[H])/C(C)N)\C(C)N |
| InChI | InChI=1S/C6H14N4/c1-3(7)5(9)6(10)4(2)8/h3-4,9-10H,7-8H2,1-2H3/b9-5+,10-6+ |
| InChIKey | GKFXIDDZKCVTDX-NXZHAISVSA-N |
| XLogP | -0.28 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diiminohexane-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diiminohexane-2,5-diamine?
The IUPAC name of 3,4-diiminohexane-2,5-diamine (CID 91176744) is 3,4-diiminohexane-2,5-diamine.
What is the SMILES notation for 3,4-diiminohexane-2,5-diamine?
The canonical SMILES for 3,4-diiminohexane-2,5-diamine is [H]/N=C(C(=N/[H])/C(C)N)\C(C)N.
What is the InChIKey of 3,4-diiminohexane-2,5-diamine?
The InChIKey is GKFXIDDZKCVTDX-NXZHAISVSA-N. The full InChI is InChI=1S/C6H14N4/c1-3(7)5(9)6(10)4(2)8/h3-4,9-10H,7-8H2,1-2H3/b9-5+,10-6+.
What are the key properties of 3,4-diiminohexane-2,5-diamine?
3,4-diiminohexane-2,5-diamine has a molecular weight of 142.21 g/mol, XLogP of -0.28, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diiminohexane-2,5-diamine is sourced from PubChem (CID 91176744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).