C12H13N5O4 — CID 91177048
3-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]-1-prop-2-enylpyrimidine-2,4-dione (PubChem CID 91177048) has the molecular formula C12H13N5O4 and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]-1-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 3-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]-1-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91177048 |
| Molecular Formula | C12H13N5O4 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]-1-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCn1ccc(=O)n(Nc2c[nH]c(=O)n(C)c2=O)c1=O |
| InChI | InChI=1S/C12H13N5O4/c1-3-5-16-6-4-9(18)17(12(16)21)14-8-7-13-11(20)15(2)10(8)19/h3-4,6-7,14H,1,5H2,2H3,(H,13,20) |
| InChIKey | RFVQTUVMZIZLRG-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|