C84H76N2 — CID 91177168
3,6-ditert-butyl-9-[4-[9-[4-[9-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]fluoren-9-yl]phenyl]fluoren-9-yl]phenyl]carbazole (PubChem CID 91177168) has the molecular formula C84H76N2 and a molecular weight of 1113.55 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-[9-[4-[9-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]fluoren-9-yl]phenyl]fluoren-9-yl]phenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-[9-[4-[9-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]fluoren-9-yl]phenyl]fluoren-9-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 91177168 |
| Molecular Formula | C84H76N2 |
| Molecular Weight | 1113.55 g/mol |
| Exact Mass | 1112.60 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-[9-[4-[9-[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]fluoren-9-yl]phenyl]fluoren-9-yl]phenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(C2(c3ccc(C4(c5ccc(-n6c7ccc(C(C)(C)C)cc7c7cc(C(C)(C)C)ccc76)cc5)c5ccccc5-c5ccccc54)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C84H76N2/c1-79(2,3)57-37-45-75-67(49-57)68-50-58(80(4,5)6)38-46-76(68)85(75)61-41-33-55(34-42-61)83(71-25-17-13-21-63(71)64-22-14-18-26-72(64)83)53-29-31-54(32-30-53)84(73-27-19-15-23-65(73)66-24-16-20-28-74(66)84)56-35-43-62(44-36-56)86-77-47-39-59(81(7,8)9)51-69(77)70-52-60(82(10,11)12)40-48-78(70)86/h13-52H,1-12H3 |
| InChIKey | FBULNRYCZZLKKQ-UHFFFAOYSA-N |
| XLogP | 21.80 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.55 |
| LogP ≤ 5 | 21.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |