About N-oxo-2,5-dihydropyridine-5-carboxamide
N-oxo-2,5-dihydropyridine-5-carboxamide (PubChem CID 91177226) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is N-oxo-2,5-dihydropyridine-5-carboxamide.
Molecular Properties
| Compound Name | N-oxo-2,5-dihydropyridine-5-carboxamide |
| PubChem CID | 91177226 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | N-oxo-2,5-dihydropyridine-5-carboxamide |
| SMILES | O=NC(=O)C1C=CCN=C1 |
| InChI | InChI=1S/C6H6N2O2/c9-6(8-10)5-2-1-3-7-4-5/h1-2,4-5H,3H2 |
| InChIKey | VXOMLWPPSRLYOA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-oxo-2,5-dihydropyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxo-2,5-dihydropyridine-5-carboxamide?
The IUPAC name of N-oxo-2,5-dihydropyridine-5-carboxamide (CID 91177226) is N-oxo-2,5-dihydropyridine-5-carboxamide.
What is the SMILES notation for N-oxo-2,5-dihydropyridine-5-carboxamide?
The canonical SMILES for N-oxo-2,5-dihydropyridine-5-carboxamide is O=NC(=O)C1C=CCN=C1.
What is the InChIKey of N-oxo-2,5-dihydropyridine-5-carboxamide?
The InChIKey is VXOMLWPPSRLYOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c9-6(8-10)5-2-1-3-7-4-5/h1-2,4-5H,3H2.
What are the key properties of N-oxo-2,5-dihydropyridine-5-carboxamide?
N-oxo-2,5-dihydropyridine-5-carboxamide has a molecular weight of 138.13 g/mol, XLogP of 0.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxo-2,5-dihydropyridine-5-carboxamide is sourced from PubChem (CID 91177226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).