C18H15BrN2O2S — CID 91177417
6-bromo-2-(3-methylphenyl)spiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 91177417) has the molecular formula C18H15BrN2O2S and a molecular weight of 403.30 g/mol. Its IUPAC name is 6-bromo-2-(3-methylphenyl)spiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-bromo-2-(3-methylphenyl)spiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 91177417 |
| Molecular Formula | C18H15BrN2O2S |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 6-bromo-2-(3-methylphenyl)spiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1cccc(C2CC3(NC(=O)NC3=O)c3cc(Br)ccc3S2)c1 |
| InChI | InChI=1S/C18H15BrN2O2S/c1-10-3-2-4-11(7-10)15-9-18(16(22)20-17(23)21-18)13-8-12(19)5-6-14(13)24-15/h2-8,15H,9H2,1H3,(H2,20,21,22,23) |
| InChIKey | RPFOSYMIFXGDTF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|