About (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole
(5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole (PubChem CID 91177580) has the molecular formula C11H15NS
and a molecular weight of 193.31 g/mol. Its IUPAC name is (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole.
Molecular Properties
| Compound Name | (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole |
| PubChem CID | 91177580 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole |
| SMILES | CC/C=C1\Cc2sc(C)cc2N1C |
| InChI | InChI=1S/C11H15NS/c1-4-5-9-7-11-10(12(9)3)6-8(2)13-11/h5-6H,4,7H2,1-3H3/b9-5+ |
| InChIKey | KSLORKGIAQRREK-WEVVVXLNSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole?
The IUPAC name of (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole (CID 91177580) is (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole.
What is the SMILES notation for (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole?
The canonical SMILES for (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole is CC/C=C1\Cc2sc(C)cc2N1C.
What is the InChIKey of (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole?
The InChIKey is KSLORKGIAQRREK-WEVVVXLNSA-N. The full InChI is InChI=1S/C11H15NS/c1-4-5-9-7-11-10(12(9)3)6-8(2)13-11/h5-6H,4,7H2,1-3H3/b9-5+.
What are the key properties of (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole?
(5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole has a molecular weight of 193.31 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2,4-dimethyl-5-propylidene-6H-thieno[3,2-b]pyrrole is sourced from PubChem (CID 91177580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).