C17H18F3N3O2S — CID 9117763
2-[[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 9117763) has the molecular formula C17H18F3N3O2S and a molecular weight of 385.41 g/mol. Its IUPAC name is 2-[[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 9117763 |
| Molecular Formula | C17H18F3N3O2S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1ccsc1CN(C)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H18F3N3O2S/c1-10-5-6-26-13(10)8-23(2)9-15(25)21-7-14(24)22-12-4-3-11(18)16(19)17(12)20/h3-6H,7-9H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | KVXWWYHPLIZCNX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|