C17H16N4 — CID 91177727
4-(3,4-dimethylindazol-1-yl)-2-(methylamino)benzonitrile (PubChem CID 91177727) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-(3,4-dimethylindazol-1-yl)-2-(methylamino)benzonitrile.
| Compound Name | 4-(3,4-dimethylindazol-1-yl)-2-(methylamino)benzonitrile |
|---|---|
| PubChem CID | 91177727 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-(3,4-dimethylindazol-1-yl)-2-(methylamino)benzonitrile |
| SMILES | CNc1cc(-n2nc(C)c3c(C)cccc32)ccc1C#N |
| InChI | InChI=1S/C17H16N4/c1-11-5-4-6-16-17(11)12(2)20-21(16)14-8-7-13(10-18)15(9-14)19-3/h4-9,19H,1-3H3 |
| InChIKey | PDPRRADKOSXTDK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |