About 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one
4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one (PubChem CID 91177856) has the molecular formula C18H23N3O3
and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one.
Molecular Properties
| Compound Name | 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one |
| PubChem CID | 91177856 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one |
| SMILES | COc1ccc(N2C(=O)OC3(C=C2N)CN2CCC3CC2)c(C)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-12-9-14(23-2)3-4-15(12)21-16(19)10-18(24-17(21)22)11-20-7-5-13(18)6-8-20/h3-4,9-10,13H,5-8,11,19H2,1-2H3 |
| InChIKey | WPKDNWSERMBYOM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one?
The IUPAC name of 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one (CID 91177856) is 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one.
What is the SMILES notation for 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one?
The canonical SMILES for 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one is COc1ccc(N2C(=O)OC3(C=C2N)CN2CCC3CC2)c(C)c1.
What is the InChIKey of 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one?
The InChIKey is WPKDNWSERMBYOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3/c1-12-9-14(23-2)3-4-15(12)21-16(19)10-18(24-17(21)22)11-20-7-5-13(18)6-8-20/h3-4,9-10,13H,5-8,11,19H2,1-2H3.
What are the key properties of 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one?
4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one has a molecular weight of 329.40 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(4-methoxy-2-methylphenyl)spiro[1,3-oxazine-6,3'-1-azabicyclo[2.2.2]octane]-2-one is sourced from PubChem (CID 91177856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).