C28H39NO7S — CID 91177872
2-[4-[4-[3-(2,2-diethoxyethoxy)phenyl]-3-methylphenyl]piperidin-1-yl]sulfonyl-2-methylpropanoic acid (PubChem CID 91177872) has the molecular formula C28H39NO7S and a molecular weight of 533.69 g/mol. Its IUPAC name is 2-[4-[4-[3-(2,2-diethoxyethoxy)phenyl]-3-methylphenyl]piperidin-1-yl]sulfonyl-2-methylpropanoic acid.
| Compound Name | 2-[4-[4-[3-(2,2-diethoxyethoxy)phenyl]-3-methylphenyl]piperidin-1-yl]sulfonyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 91177872 |
| Molecular Formula | C28H39NO7S |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 2-[4-[4-[3-(2,2-diethoxyethoxy)phenyl]-3-methylphenyl]piperidin-1-yl]sulfonyl-2-methylpropanoic acid |
| SMILES | CCOC(COc1cccc(-c2ccc(C3CCN(S(=O)(=O)C(C)(C)C(=O)O)CC3)cc2C)c1)OCC |
| InChI | InChI=1S/C28H39NO7S/c1-6-34-26(35-7-2)19-36-24-10-8-9-23(18-24)25-12-11-22(17-20(25)3)21-13-15-29(16-14-21)37(32,33)28(4,5)27(30)31/h8-12,17-18,21,26H,6-7,13-16,19H2,1-5H3,(H,30,31) |
| InChIKey | KYZUMEBHJCDWJP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|