About 4-N,4-N'-dimethylpiperidine-4,4-diamine
4-N,4-N'-dimethylpiperidine-4,4-diamine (PubChem CID 91177983) has the molecular formula C7H17N3
and a molecular weight of 143.23 g/mol. Its IUPAC name is 4-N,4-N'-dimethylpiperidine-4,4-diamine.
Molecular Properties
| Compound Name | 4-N,4-N'-dimethylpiperidine-4,4-diamine |
| PubChem CID | 91177983 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 4-N,4-N'-dimethylpiperidine-4,4-diamine |
| SMILES | CNC1(NC)CCNCC1 |
| InChI | InChI=1S/C7H17N3/c1-8-7(9-2)3-5-10-6-4-7/h8-10H,3-6H2,1-2H3 |
| InChIKey | TWLWAUAQOCCNDI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N'-dimethylpiperidine-4,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N'-dimethylpiperidine-4,4-diamine?
The IUPAC name of 4-N,4-N'-dimethylpiperidine-4,4-diamine (CID 91177983) is 4-N,4-N'-dimethylpiperidine-4,4-diamine.
What is the SMILES notation for 4-N,4-N'-dimethylpiperidine-4,4-diamine?
The canonical SMILES for 4-N,4-N'-dimethylpiperidine-4,4-diamine is CNC1(NC)CCNCC1.
What is the InChIKey of 4-N,4-N'-dimethylpiperidine-4,4-diamine?
The InChIKey is TWLWAUAQOCCNDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3/c1-8-7(9-2)3-5-10-6-4-7/h8-10H,3-6H2,1-2H3.
What are the key properties of 4-N,4-N'-dimethylpiperidine-4,4-diamine?
4-N,4-N'-dimethylpiperidine-4,4-diamine has a molecular weight of 143.23 g/mol, XLogP of -0.50, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N'-dimethylpiperidine-4,4-diamine is sourced from PubChem (CID 91177983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).