C28H31ClN2O5S — CID 91178758
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]oxane-2,4-dione (PubChem CID 91178758) has the molecular formula C28H31ClN2O5S and a molecular weight of 543.09 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91178758 |
| Molecular Formula | C28H31ClN2O5S |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]oxane-2,4-dione |
| SMILES | CCOc1ccc2nc(SC3C(=O)CC(CCc4ccc(OC)c(Cl)c4)(C4CCCC4)OC3=O)[nH]c2c1 |
| InChI | InChI=1S/C28H31ClN2O5S/c1-3-35-19-9-10-21-22(15-19)31-27(30-21)37-25-23(32)16-28(36-26(25)33,18-6-4-5-7-18)13-12-17-8-11-24(34-2)20(29)14-17/h8-11,14-15,18,25H,3-7,12-13,16H2,1-2H3,(H,30,31) |
| InChIKey | HABZBHNXIXAFTG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|