C20H36O2Si — CID 91178780
bis(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yloxy)-dimethylsilane (PubChem CID 91178780) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is bis(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yloxy)-dimethylsilane.
| Compound Name | bis(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yloxy)-dimethylsilane |
|---|---|
| PubChem CID | 91178780 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | bis(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yloxy)-dimethylsilane |
| SMILES | C[Si](C)(OC1CCC2CCCCC21)OC1CCC2CCCCC21 |
| InChI | InChI=1S/C20H36O2Si/c1-23(2,21-19-13-11-15-7-3-5-9-17(15)19)22-20-14-12-16-8-4-6-10-18(16)20/h15-20H,3-14H2,1-2H3 |
| InChIKey | HPFLHNFNEYDRHR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|