About 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine
2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine (PubChem CID 91179638) has the molecular formula C4H6N8
and a molecular weight of 166.15 g/mol. Its IUPAC name is 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine.
Molecular Properties
| Compound Name | 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine |
| PubChem CID | 91179638 |
| Molecular Formula | C4H6N8 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine |
| SMILES | N#C/N=C(\N)NN/C(N)=N/C#N |
| InChI | InChI=1S/C4H6N8/c5-1-9-3(7)11-12-4(8)10-2-6/h(H3,7,9,11)(H3,8,10,12) |
| InChIKey | KDCPAPMHYWAGHA-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine?
The IUPAC name of 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine (CID 91179638) is 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine.
What is the SMILES notation for 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine?
The canonical SMILES for 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine is N#C/N=C(\N)NN/C(N)=N/C#N.
What is the InChIKey of 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine?
The InChIKey is KDCPAPMHYWAGHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N8/c5-1-9-3(7)11-12-4(8)10-2-6/h(H3,7,9,11)(H3,8,10,12).
What are the key properties of 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine?
2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine has a molecular weight of 166.15 g/mol, XLogP of -2.33, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-1-[(N'-cyanocarbamimidoyl)amino]guanidine is sourced from PubChem (CID 91179638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).