C26H33NO3 — CID 91179977
methyl 5-[3-[4-(5-methyl-2-phenyl-2,3-dihydro-1,3-oxazol-4-yl)butyl]phenyl]pentanoate (PubChem CID 91179977) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is methyl 5-[3-[4-(5-methyl-2-phenyl-2,3-dihydro-1,3-oxazol-4-yl)butyl]phenyl]pentanoate.
| Compound Name | methyl 5-[3-[4-(5-methyl-2-phenyl-2,3-dihydro-1,3-oxazol-4-yl)butyl]phenyl]pentanoate |
|---|---|
| PubChem CID | 91179977 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | methyl 5-[3-[4-(5-methyl-2-phenyl-2,3-dihydro-1,3-oxazol-4-yl)butyl]phenyl]pentanoate |
| SMILES | COC(=O)CCCCc1cccc(CCCCC2=C(C)OC(c3ccccc3)N2)c1 |
| InChI | InChI=1S/C26H33NO3/c1-20-24(27-26(30-20)23-15-4-3-5-16-23)17-8-6-11-21-13-10-14-22(19-21)12-7-9-18-25(28)29-2/h3-5,10,13-16,19,26-27H,6-9,11-12,17-18H2,1-2H3 |
| InChIKey | YXBJWHMBONUUTA-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|