C23H28ClF3N6O3 — CID 91180390
2-N-[[5-chloro-2-(trifluoromethoxy)phenyl]methyl]-5-nitro-4-N-[(1-pyrrolidin-3-ylcyclohexyl)methyl]pyrimidine-2,4-diamine (PubChem CID 91180390) has the molecular formula C23H28ClF3N6O3 and a molecular weight of 528.96 g/mol. Its IUPAC name is 2-N-[[5-chloro-2-(trifluoromethoxy)phenyl]methyl]-5-nitro-4-N-[(1-pyrrolidin-3-ylcyclohexyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[[5-chloro-2-(trifluoromethoxy)phenyl]methyl]-5-nitro-4-N-[(1-pyrrolidin-3-ylcyclohexyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91180390 |
| Molecular Formula | C23H28ClF3N6O3 |
| Molecular Weight | 528.96 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2-N-[[5-chloro-2-(trifluoromethoxy)phenyl]methyl]-5-nitro-4-N-[(1-pyrrolidin-3-ylcyclohexyl)methyl]pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NCc2cc(Cl)ccc2OC(F)(F)F)nc1NCC1(C2CCNC2)CCCCC1 |
| InChI | InChI=1S/C23H28ClF3N6O3/c24-17-4-5-19(36-23(25,26)27)15(10-17)11-29-21-30-13-18(33(34)35)20(32-21)31-14-22(7-2-1-3-8-22)16-6-9-28-12-16/h4-5,10,13,16,28H,1-3,6-9,11-12,14H2,(H2,29,30,31,32) |
| InChIKey | DAGGLVDHRFGUTE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.96 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|