C19H33N5O8 — CID 91180511
(3R)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-1-(hexylcarbamoyloxy)-2,3-dihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 91180511) has the molecular formula C19H33N5O8 and a molecular weight of 459.50 g/mol. Its IUPAC name is (3R)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-1-(hexylcarbamoyloxy)-2,3-dihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (3R)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-1-(hexylcarbamoyloxy)-2,3-dihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 91180511 |
| Molecular Formula | C19H33N5O8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (3R)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-1-(hexylcarbamoyloxy)-2,3-dihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCCCCNC(=O)O[C@@H](C1[C@@H](C(C=C(O1)C(=O)O)N=C(N)N)NC(=O)C)[C@@H](CO)O |
| InChI | InChI=1S/C19H33N5O8/c1-3-4-5-6-7-22-19(30)32-15(12(27)9-25)16-14(23-10(2)26)11(24-18(20)21)8-13(31-16)17(28)29/h8,11-12,14-16,25,27H,3-7,9H2,1-2H3,(H,22,30)(H,23,26)(H,28,29)(H4,20,21,24)/t11?,12-,14-,15-,16?/m1/s1 |
| InChIKey | UMNAPWVKPPHJET-VXURVKEPSA-N |
| XLogP | -1.00 |
| TPSA | 219.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | 710 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|