C32H50N2O4 — CID 91180910
[(2S,3S,4S,6R,7R,14R)-4-buta-1,3-dienyl-2,3,4,7,14-pentamethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(3R,4S)-1,4-dimethylpiperidine-3-carbonyl]carbamate (PubChem CID 91180910) has the molecular formula C32H50N2O4 and a molecular weight of 526.76 g/mol. Its IUPAC name is [(2S,3S,4S,6R,7R,14R)-4-buta-1,3-dienyl-2,3,4,7,14-pentamethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(3R,4S)-1,4-dimethylpiperidine-3-carbonyl]carbamate.
| Compound Name | [(2S,3S,4S,6R,7R,14R)-4-buta-1,3-dienyl-2,3,4,7,14-pentamethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(3R,4S)-1,4-dimethylpiperidine-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 91180910 |
| Molecular Formula | C32H50N2O4 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.38 |
| IUPAC Name | [(2S,3S,4S,6R,7R,14R)-4-buta-1,3-dienyl-2,3,4,7,14-pentamethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(3R,4S)-1,4-dimethylpiperidine-3-carbonyl]carbamate |
| SMILES | C=CC=C[C@]1(C)C[C@@H](OC(=O)NC(=O)[C@H]2CN(C)CC[C@@H]2C)[C@@]2(C)C3C(=O)CCC3(CC[C@H]2C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C32H50N2O4/c1-9-10-14-30(6)18-26(38-29(37)33-28(36)24-19-34(8)17-13-20(24)2)31(7)21(3)11-15-32(23(5)22(30)4)16-12-25(35)27(31)32/h9-10,14,20-24,26-27H,1,11-13,15-19H2,2-8H3,(H,33,36,37)/t20-,21+,22-,23-,24-,26+,27?,30+,31-,32?/m0/s1 |
| InChIKey | XTZXVSMXJBWZHM-AVMSYHBESA-N |
| XLogP | 6.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|