About 3-amino-N'-(2-methoxyacetyl)propanehydrazide
3-amino-N'-(2-methoxyacetyl)propanehydrazide (PubChem CID 91181082) has the molecular formula C6H13N3O3
and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-amino-N'-(2-methoxyacetyl)propanehydrazide.
Molecular Properties
| Compound Name | 3-amino-N'-(2-methoxyacetyl)propanehydrazide |
| PubChem CID | 91181082 |
| Molecular Formula | C6H13N3O3 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-amino-N'-(2-methoxyacetyl)propanehydrazide |
| SMILES | COCC(=O)NNC(=O)CCN |
| InChI | InChI=1S/C6H13N3O3/c1-12-4-6(11)9-8-5(10)2-3-7/h2-4,7H2,1H3,(H,8,10)(H,9,11) |
| InChIKey | DCSWURCQECDUEK-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N'-(2-methoxyacetyl)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N'-(2-methoxyacetyl)propanehydrazide?
The IUPAC name of 3-amino-N'-(2-methoxyacetyl)propanehydrazide (CID 91181082) is 3-amino-N'-(2-methoxyacetyl)propanehydrazide.
What is the SMILES notation for 3-amino-N'-(2-methoxyacetyl)propanehydrazide?
The canonical SMILES for 3-amino-N'-(2-methoxyacetyl)propanehydrazide is COCC(=O)NNC(=O)CCN.
What is the InChIKey of 3-amino-N'-(2-methoxyacetyl)propanehydrazide?
The InChIKey is DCSWURCQECDUEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O3/c1-12-4-6(11)9-8-5(10)2-3-7/h2-4,7H2,1H3,(H,8,10)(H,9,11).
What are the key properties of 3-amino-N'-(2-methoxyacetyl)propanehydrazide?
3-amino-N'-(2-methoxyacetyl)propanehydrazide has a molecular weight of 175.19 g/mol, XLogP of -1.87, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N'-(2-methoxyacetyl)propanehydrazide is sourced from PubChem (CID 91181082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).