C29H40F3N7O2S — CID 91182996
propan-2-yl 6-[1-[6-propyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-yl]piperidin-3-yl]hexanoate (PubChem CID 91182996) has the molecular formula C29H40F3N7O2S and a molecular weight of 607.75 g/mol. Its IUPAC name is propan-2-yl 6-[1-[6-propyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-yl]piperidin-3-yl]hexanoate.
| Compound Name | propan-2-yl 6-[1-[6-propyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-yl]piperidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 91182996 |
| Molecular Formula | C29H40F3N7O2S |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | propan-2-yl 6-[1-[6-propyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-yl]piperidin-3-yl]hexanoate |
| SMILES | CCCc1cc2c(N3CCn4c(nnc4C(F)(F)F)C3)nc(N3CCCC(CCCCCC(=O)OC(C)C)C3)nc2s1 |
| InChI | InChI=1S/C29H40F3N7O2S/c1-4-9-21-16-22-25(37-14-15-39-23(18-37)35-36-27(39)29(30,31)32)33-28(34-26(22)42-21)38-13-8-11-20(17-38)10-6-5-7-12-24(40)41-19(2)3/h16,19-20H,4-15,17-18H2,1-3H3 |
| InChIKey | BAEIUSUXNDNJPB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|